For research use only. Not for therapeutic Use.
ALDH1A1-IN-2（Cat No.:I044114）is a potent and selective inhibitor of aldehyde dehydrogenase 1A1 (ALDH1A1), an enzyme involved in the oxidation of retinaldehyde to retinoic acid. ALDH1A1 is often overexpressed in cancer stem cells and is associated with chemoresistance and poor prognosis in several cancers. ALDH1A1-IN-2 is widely used in research to target cancer stem-like cells, study metabolic reprogramming, and evaluate combination therapies that enhance chemotherapeutic efficacy. Its high selectivity makes it a valuable tool for dissecting ALDH1A1-specific functions in oncology and stem cell biology, advancing the development of targeted cancer treatments.
| CAS Number | 2231081-18-6 |
| Synonyms | 1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile |
| Molecular Formula | C25H23ClN4O3S |
| Purity | ≥95% |
| IUPAC Name | 1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile |
| InChI | InChI=1S/C25H23ClN4O3S/c1-34(32,33)30-12-10-29(11-13-30)24(31)21-15-28-22-7-6-19(26)14-20(22)23(21)17-2-4-18(5-3-17)25(16-27)8-9-25/h2-7,14-15H,8-13H2,1H3 |
| InChIKey | MIVWUIQZCQTJER-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C(=O)C2=CN=C3C=CC(=CC3=C2C4=CC=C(C=C4)C5(CC5)C#N)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
