For research use only. Not for therapeutic Use.
AGI-41998（Cat No.:I043987）is a potent small molecule inhibitor that targets specific enzymes involved in various cellular processes, including cell proliferation and survival. It is primarily studied for its role in inhibiting kinases and other molecular pathways that contribute to cancer progression and metastasis. AGI-41998 has shown promise in preclinical research for its ability to modulate tumor growth by blocking key signaling networks. This compound is valuable in drug discovery and cancer research, offering potential for the development of targeted therapies aimed at disrupting cancer cell survival mechanisms and improving treatment outcomes.
| CAS Number | 2377492-26-5 |
| Synonyms | 8-(4-bromophenyl)-6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one |
| Molecular Formula | C22H16BrF3N4O2 |
| Purity | ≥95% |
| IUPAC Name | 8-(4-bromophenyl)-6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C22H16BrF3N4O2/c1-32-17-8-6-16(7-9-17)30-11-14-10-27-21(28-12-22(24,25)26)29-19(14)18(20(30)31)13-2-4-15(23)5-3-13/h2-11H,12H2,1H3,(H,28,29) |
| InChIKey | QHXQQFITXAUNPR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C=C3C=NC(=NC3=C(C2=O)C4=CC=C(C=C4)Br)NCC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
