For research use only. Not for therapeutic Use.
Afabicin(Cat No.:I001263)is a novel antibiotic belonging to the fabimycin class, specifically targeting Gram-positive bacterial infections, including those caused by methicillin-resistant Staphylococcus aureus (MRSA). It works by inhibiting the bacterial enzyme FabI, crucial for fatty acid synthesis, thus impairing bacterial cell membrane production and leading to cell death. Afabicin’s high specificity and efficacy make it a promising candidate for treating severe and resistant bacterial infections. Its development represents a significant advancement in combating antibiotic resistance, offering new hope for effective treatments against difficult-to-treat Gram-positive pathogens.
CAS Number | 1518800-35-5 |
Synonyms | Afabicin;(E)-(6-(3-(methyl((3-methylbenzofuran-2-yl)methyl)amino)-3-oxoprop-1-en-1-yl)-2-oxo-3,4-dihydro-1,8-naphthyridin-1(2H)-yl)methyl dihydrogen phosphate |
Molecular Formula | C23H24N3O7P |
Purity | ≥95% |
Target | Bacterial |
Solubility | Soluble in DMSO |
Storage | 0 - 4°Cfor short term (days to weeks), or -20 °C for long term (months). |
IUPAC Name | [6-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl dihydrogen phosphate |
InChI | InChI=1S/C23H24N3O7P/c1-15-18-5-3-4-6-19(18)33-20(15)13-25(2)21(27)9-7-16-11-17-8-10-22(28)26(23(17)24-12-16)14-32-34(29,30)31/h3-7,9,11-12H,8,10,13-14H2,1-2H3,(H2,29,30,31)/b9-7+ |
InChIKey | HFYMDQMXVPJNTH-VQHVLOKHSA-N |
SMILES | CC1=C(OC2=CC=CC=C12)CN(C)C(=O)C=CC3=CC4=C(N=C3)N(C(=O)CC4)COP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |