For research use only. Not for therapeutic Use.
Adipic acid (Cat No.: R042069) is a white, crystalline dicarboxylic acid with the formula (CH₂)₄(COOH)₂, widely used in the production of nylon-6,6 through polycondensation with hexamethylenediamine. It also serves as a precursor for plasticizers, polyurethane resins, lubricants, and food additives (as an acidity regulator). Its linear six-carbon structure and dual carboxylic acid groups make it a versatile building block in polymer and chemical manufacturing. Adipic acid is industrially produced from cyclohexanone or cyclohexanol and is intended for manufacturing and research use.
| CAS Number | 124-04-9 |
| Synonyms | Adipic Acid; 1,4-Butanedicarboxylic Acid; 1,6-Hexanedioic Acid; Acifloctin; Acinetten; Adilactetten; Adipinic Acid; Asapic; E 355; Inipol DS; NSC 7622; NSC 87836 |
| Molecular Formula | C6H10O4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | hexanedioic acid |
| InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| InChIKey | WNLRTRBMVRJNCN-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)O)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
