Dipropylene glycol (mixture of isomers) is a colorless, odorless liquid. It is composed of various isomers of propylene glycol with two hydroxyl groups (-OH) attached to different carbon atoms in the propane backbone. This compound is widely used as a solvent, humectant, and viscosity modifier in various industries, including cosmetics, personal care products, pharmaceuticals, and food additives. It functions as a stable, low-volatility solvent and diluent, offering excellent solubility for a variety of substances.
| Catalog Number | R017746 |
| CAS Number | 110-98-5 |
| Synonyms | 1,1’-Dimethyldiethylene glycol; 1,1’-Oxydi-2-propanol; 1,1’-Oxydi-2-propanol; Bis(2-hydroxypropyl) Ether |
| Molecular Formula | C6H14O3 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1-(2-hydroxypropoxy)propan-2-ol |
| InChI | InChI=1S/C6H14O3/c1-5(7)3-9-4-6(2)8/h5-8H,3-4H2,1-2H3 |
| InChIKey | AZUXKVXMJOIAOF-UHFFFAOYSA-N |
| SMILES | CC(COCC(C)O)O |
