For research use only. Not for therapeutic Use.
Adipic acid-d10(Cat No.:R044945)is a deuterated variant of adipic acid, where all ten hydrogen atoms are replaced by deuterium, a heavier isotope of hydrogen. This modification makes adipic acid-d10 particularly useful in research applications, including studies that involve nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and other analytical techniques. By using deuterium, researchers can achieve better resolution and sensitivity in these analyses. Adipic acid-d10 is often used in metabolic tracing, chemical reactions, and polymer synthesis, allowing scientists to track molecular behavior or study complex processes involving this compound.
CAS Number | 25373-21-1 |
Synonyms | dideuterio 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
Molecular Formula | C6D10O4 |
Purity | ≥95% |
IUPAC Name | dideuterio 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)/i1D2,2D2,3D2,4D2/hD2 |
InChIKey | WNLRTRBMVRJNCN-YQMDOBQVSA-N |
SMILES | [2H]C([2H])(C(=O)O[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |