1. Home
  2. Product
  3. Inhibitors/Agonists
  4. Adenosine amine congener

Adenosine amine congener - CAS 96760-69-9

Adenosine amine congener (Cat No.:I017395) is a compound that acts as a selective agonist for the A1 adenosine receptor. It has been shown to have beneficial effects in the context of noise-induced and cisplatin-induced cochlear injury. By activating A1 adenosine receptors, ADAC can ameliorate cochlear damage caused by excessive noise exposure or cisplatin administration. Additionally, ADAC exhibits neuroprotective properties, providing protection against neuronal damage and promoting cell survival in various experimental models.

Catalog Number: I017395

CAS Number: 96760-69-9

Molecular Formula: C₂₈H₃₂N₈O₆

Molecular Weight:576.60

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C₂₈H₃₂N₈O₆
Molecular Weight576.60
Purity≥95%
StorageRoom Temperature

Computed Descriptor

IUPAC NameN-(2-aminoethyl)-2-[4-[[2-[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]acetyl]amino]phenyl]acetamide
InChIInChI=1S/C28H32N8O6/c29-9-10-30-21(38)11-16-1-5-18(6-2-16)34-22(39)12-17-3-7-19(8-4-17)35-26-23-27(32-14-31-26)36(15-33-23)28-25(41)24(40)20(13-37)42-28/h1-8,14-15,20,24-25,28,37,40-41H,9-13,29H2,(H,30,38)(H,34,39)(H,31,32,35)/t20-,24-,25-,28-/m1/s1
InChIKeyJFRJCQJVFMHZOO-QZHHGCDDSA-N
SMILESC1=CC(=CC=C1CC(=O)NC2=CC=C(C=C2)CC(=O)NCCN)NC3=C4C(=NC=N3)N(C=N4)C5C(C(C(O5)CO)O)O