For research use only. Not for therapeutic Use.
ACH-000143（Cat No.:I021284）is a potent, selective inhibitor of lysine-specific demethylase 1 (LSD1/KDM1A), an epigenetic enzyme involved in gene repression and cancer progression. By inhibiting LSD1, ACH-000143 disrupts the demethylation of histone H3K4me1/2, leading to reactivation of silenced tumor suppressor genes and induction of differentiation in cancer cells. It has demonstrated promising preclinical efficacy, particularly in hematologic malignancies such as acute myeloid leukemia (AML). ACH-000143’s targeted mechanism positions it as a valuable tool for studying epigenetic regulation and as a potential therapeutic candidate in epigenetically driven cancers.
| CAS Number | 2225836-30-4 |
| Synonyms | N-[2-(5-chloro-2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
| Molecular Formula | C13H16ClN3O3 |
| Purity | ≥95% |
| IUPAC Name | N-[2-(5-chloro-2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
| InChI | InChI=1S/C13H16ClN3O3/c1-8(18)15-4-5-17-11-7-12(19-2)9(14)6-10(11)16-13(17)20-3/h6-7H,4-5H2,1-3H3,(H,15,18) |
| InChIKey | BVSLRGAPRGQWNC-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCN1C2=CC(=C(C=C2N=C1OC)Cl)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
