8-Prenylnaringenin (Cat.No:R064414) is a natural compound found in hops (Humulus lupulus) and beer. It is a potent phytoestrogen with estrogenic effects and has been studied for its potential health benefits, including anti-inflammatory, antioxidant, and anticancer properties.
| Catalog Number | R064414 |
| CAS Number | 53846-50-7 |
| Synonyms | (2S)-2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one |
| Molecular Formula | C20H20O5 |
| Purity | 95% |
| Target | Estrogen/progestogen Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/t18-/m0/s1 |
| InChIKey | LPEPZZAVFJPLNZ-SFHVURJKSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)O)C |
