8-Fluoro-6-methoxy Moxifloxacin Dihydrochloride (Cat.No:R012342) is a chemical compound with potential pharmaceutical applications. It is likely a derivative of Moxifloxacin, a widely used antibiotic. The addition of a fluoro and a methoxy group may confer altered pharmacological properties, potentially enhancing its effectiveness in treating bacterial infections.
| Catalog Number | R012342 |
| CAS Number | 1029364-77-9 |
| Synonyms | 1-Cyclopropyl-8-fluoro-1,4-dihydro-6-methoxy-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-3-quinolinecarboxylic Acid Dihydrochloride; Moxifloxacin Imp. D (EP/BP) as diHCl salt |
| Molecular Formula | C21H24FN3O4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-fluoro-6-methoxy-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C21H24FN3O4/c1-29-16-7-13-18(25(12-4-5-12)9-14(20(13)26)21(27)28)17(22)19(16)24-8-11-3-2-6-23-15(11)10-24/h7,9,11-12,15,23H,2-6,8,10H2,1H3,(H,27,28)/t11-,15+/m0/s1 |
| InChIKey | UGXNFVOVJRJWHB-XHDPSFHLSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=O)C(=CN2C3CC3)C(=O)O)F)N4CC5CCCNC5C4 |
