Home
>
Inhibitors/Agonists>MAPK/ERK Pathway>MEK>
>
6,7-Dimethoxy-N-(3-phenoxyphenyl)quinolin-4-amine hydrochloride
6,7-Dimethoxy-N-(3-phenoxyphenyl)quinolin-4-amine hydrochloride (Cat No.:L003673) is an organic compound with a quinoline ring, a 3-phenoxyphenyl group, and amine substitution at position 4, along with two methoxy groups at positions 6 and 7. In the hydrochloride salt form, it enhances stability and solubility. This complex structure may have potential applications in pharmaceutical research, where quinoline-based compounds are relevant for drug discovery. The phenoxy phenyl group introduces specific chemical properties, making it valuable in medicinal chemistry for designing new bioactive molecules or as a precursor for synthetic intermediates.
Catalog Number | L003673 |
CAS Number | 179246-08-3 |
Molecular Formula | C23H21ClN2O3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 6,7-dimethoxy-N-(3-phenoxyphenyl)quinolin-4-amine;hydrochloride |
InChI | InChI=1S/C23H20N2O3.ClH/c1-26-22-14-19-20(11-12-24-21(19)15-23(22)27-2)25-16-7-6-10-18(13-16)28-17-8-4-3-5-9-17;/h3-15H,1-2H3,(H,24,25);1H |
InChIKey | JUBMXFSNRBUGQI-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1OC)NC3=CC(=CC=C3)OC4=CC=CC=C4.Cl |