For research use only. Not for therapeutic Use.
6-Hydroxybenzbromarone(CAT: I016839) is the major active metabolite of benzbromarone, exhibiting a longer half-life and greater pharmacological potency than its parent compound. Identified as a protein Eyes Absent 3 (EYA3) inhibitor (IC₅₀ = 21.5 μM), it demonstrates strong anti-angiogenic activity, suppressing endothelial cell migration, tubulogenesis, and angiogenic sprouting. At 7.5 μM for 72 hours, it reduces cell proliferation by over 50%, while also decreasing viability in comparison to benzbromarone. In HUVEC models, 6-Hydroxybenzbromarone significantly impairs tube formation and angiogenesis, though its effects may be attenuated under high-serum conditions. This compound is a valuable probe for studying angiogenesis, cancer biology, and vascular disease.
| CAS Number | 152831-00-0 |
| Synonyms | (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone |
| Molecular Formula | C17H12Br2O4 |
| Purity | ≥95% |
| IUPAC Name | (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone |
| InChI | InChI=1S/C17H12Br2O4/c1-2-13-15(10-4-3-9(20)7-14(10)23-13)16(21)8-5-11(18)17(22)12(19)6-8/h3-7,20,22H,2H2,1H3 |
| InChIKey | FEXBXMFVRKZOOZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(O1)C=C(C=C2)O)C(=O)C3=CC(=C(C(=C3)Br)O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
