For research use only. Not for therapeutic Use.
2-(Methylamino)-1H-purine-6 (7H)-one(Cat No.:M120255), also known as N2-Methylguanine, is a modified nucleoside that occurs naturally as an endogenous methylated nucleoside in body fluids. It is formed by the methylation of the guanine base in nucleic acids. N2-Methylguanine is involved in various cellular processes and has been studied for its potential role in DNA repair and mutagenesis. The presence of N2-Methylguanine in body fluids provides a valuable biomarker for assessing exposure to methylating agents and understanding their effects on DNA integrity and cellular processes.
| CAS Number | 10030-78-1 |
| Molecular Formula | C6H7N5O |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 2-(methylamino)-1,7-dihydropurin-6-one |
| InChI | InChI=1S/C6H7N5O/c1-7-6-10-4-3(5(12)11-6)8-2-9-4/h2H,1H3,(H3,7,8,9,10,11,12) |
| InChIKey | SGSSKEDGVONRGC-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(C(=O)N1)NC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |