For research use only. Not for therapeutic Use.
6-Chlorothymol(CAT: M015279) is a high-purity aromatic compound featuring a chlorinated thymol core, which consists of a phenolic structure with a methyl and isopropyl group. This unique structure makes it valuable in pharmaceutical research, agrochemical development, and as an intermediate in the synthesis of bioactive molecules. The chlorination enhances its reactivity and biological activity, making it suitable for developing antimicrobial agents, functionalized derivatives, and small-molecule inhibitors. Known for its stability and versatility, 6-Chlorothymol supports precision chemical synthesis and innovative applications in medicinal chemistry and material science, offering reliability for both academic and industrial research settings.
CAS Number | 89-68-9 |
Synonyms | 4-chloro-5-methyl-2-(1-methylethyl)-pheno;4-chloro-5-methyl-2-(1-methylethyl)phenol;4-Chloro-6-isopropyl-3-methylphenol;4-Chlorothymol;6-chloro-thymo;Chlorthymol;Phenol, 4-chloro-5-methyl-2-(1-methylethyl)-;Thymol, 6-chloro- |
Molecular Formula | C10H13ClO |
Purity | ≥95% |
Storage | <label class= |
IUPAC Name | 4-chloro-5-methyl-2-propan-2-ylphenol |
InChI | InChI=1S/C10H13ClO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,12H,1-3H3 |
InChIKey | KFZXVMNBUMVKLN-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1Cl)C(C)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |