For research use only. Not for therapeutic Use.
6-Chloro-1,3-dimethyluracil(Cat No.:M298195), is a chemical compound with the molecular formula C6H7ClN2O2. It features a uracil ring structure with a chlorine atom attached, and two methyl groups (-CH3) at different positions. This compound’s structure suggests its potential applications in organic synthesis and as a building block for creating diverse molecules. The presence of the chlorine atom and the methyl groups on the uracil ring can impact its reactivity, making it valuable for preparing specialized compounds used in pharmaceuticals, agrochemicals, and other fine chemicals.
CAS Number | 6972-27-6 |
Molecular Formula | C6H7ClN2O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 6-chloro-1,3-dimethylpyrimidine-2,4-dione |
InChI | InChI=1S/C6H7ClN2O2/c1-8-4(7)3-5(10)9(2)6(8)11/h3H,1-2H3 |
InChIKey | VATQPUHLFQHDBD-UHFFFAOYSA-N |
SMILES | CN1C(=CC(=O)N(C1=O)C)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |