For research use only. Not for therapeutic Use.
5-Phenylpenta-2,4-dienoic acid(Cat No.:M047054)is an organic compound featuring a conjugated diene system with a phenyl group, giving it unique chemical properties. This compound is used in organic synthesis and research due to its reactive structure, making it a valuable intermediate for creating more complex molecules in pharmaceuticals and materials science. Its conjugated double bonds allow it to participate in various reactions, including polymerization and cross-linking. Studied for its potential bioactivity, 5-phenylpenta-2,4-dienoic acid offers applications in medicinal chemistry for developing new therapeutic agents.
| CAS Number | 1552-94-9 |
| Molecular Formula | C11H10O2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | (2E,4E)-5-phenylpenta-2,4-dienoic acid |
| InChI | InChI=1S/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
| InChIKey | FEIQOMCWGDNMHM-KBXRYBNXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |