For research use only. Not for therapeutic Use.
5-Hydroxy-1,4-naphthoquinone(Cat No.:R064250), also known as juglone, is a natural organic compound commonly found in walnut trees (Juglans species) and some other plants. It is recognized for its biological activities, including antimicrobial, antifungal, and antioxidant properties. Juglone disrupts cellular processes by generating reactive oxygen species, making it a useful tool in biochemical research for studying oxidative stress and apoptosis. Additionally, 5-Hydroxy-1,4-naphthoquinone is explored for potential therapeutic applications, such as cancer treatment and natural pest control, due to its bioactivity against certain pathogens and insect species.
CAS Number | 481-39-0 |
Synonyms | 5-Hydroxy-1,4-naphthalenedione; Juglone;?1,4-Dihydro-1,4-dioxo-5-hydroxynaphthalene; |
Molecular Formula | C10H6O3 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | 5-hydroxynaphthalene-1,4-dione |
InChI | InChI=1S/C10H6O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-5,12H |
InChIKey | KQPYUDDGWXQXHS-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=O)C=CC2=O)C(=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |