4,5,6-Trihydroxybenzene-1,3-dicarbaldehyde - CAS 58343-12-7

4,5,6-Trihydroxybenzene-1,3-dicarbaldehyde(Cat No.:L007675), is a chemical compound consisting of a benzene ring with three hydroxyl groups at the 4, 5, and 6 positions and two aldehyde groups at the 1 and 3 positions. This specific molecular structure is significant in organic synthesis and chemical research. Researchers use it as a reagent and intermediate in various chemical reactions, contributing to the synthesis of complex organic compounds. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of specialty chemicals, contributing to advancements in chemical research and industrial applications.

Catalog Number: L007675

CAS Number: 58343-12-7

Molecular Formula: C8H6O5

Molecular Weight:182.13

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C8H6O5
Molecular Weight182.13
Purity≥95%

Computed Descriptor

IUPAC Name4,5,6-trihydroxybenzene-1,3-dicarbaldehyde
InChIInChI=1S/C8H6O5/c9-2-4-1-5(3-10)7(12)8(13)6(4)11/h1-3,11-13H
InChIKeyRUJNFDVEPQRMOS-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1C=O)O)O)O)C=O