4,5,6-Trihydroxybenzene-1,3-dicarbaldehyde（Cat No.:L007675）, is a chemical compound consisting of a benzene ring with three hydroxyl groups at the 4, 5, and 6 positions and two aldehyde groups at the 1 and 3 positions. This specific molecular structure is significant in organic synthesis and chemical research. Researchers use it as a reagent and intermediate in various chemical reactions, contributing to the synthesis of complex organic compounds. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of specialty chemicals, contributing to advancements in chemical research and industrial applications.
| Catalog Number | L007675 |
| CAS Number | 58343-12-7 |
| Molecular Formula | C8H6O5 |
| Purity | 95% |
| IUPAC Name | 4,5,6-trihydroxybenzene-1,3-dicarbaldehyde |
| InChI | InChI=1S/C8H6O5/c9-2-4-1-5(3-10)7(12)8(13)6(4)11/h1-3,11-13H |
| InChIKey | RUJNFDVEPQRMOS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1C=O)O)O)O)C=O |
