For research use only. Not for therapeutic Use.
4-Chloro-N,N-dimethyl-2-butanamine hydrochloride (Cat No.: R025891) is a quaternary ammonium salt featuring a dimethylamino group and a chloro-substituted butyl chain. As a hydrochloride salt, it offers improved stability and water solubility, making it suitable for various chemical and pharmaceutical applications. The compound serves as a versatile intermediate in organic synthesis, particularly in the preparation of amines, heterocycles, and functionalized molecules. Its reactive chloro group enables nucleophilic substitution, while the dimethylamino moiety contributes to its utility in drug development and fine chemical production.
CAS Number | 31412-48-3 |
Synonyms | 3-Chloro-N,N,1-trimethylpropylamine Hydrochloride |
Molecular Formula | C6H15Cl2N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 4-chloro-N,N-dimethylbutan-2-amine;hydrochloride |
InChI | InChI=1S/C6H14ClN.ClH/c1-6(4-5-7)8(2)3;/h6H,4-5H2,1-3H3;1H |
InChIKey | WAYIPWADQSUKKK-UHFFFAOYSA-N |
SMILES | CC(CCCl)N(C)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |