For research use only. Not for therapeutic Use.
3-Thiophenacetic acid (Cat.No:M289945) is a chemical compound containing a thiophene ring. It is used as a building block in organic synthesis, particularly in the pharmaceutical and agrochemical industries. This compound serves as a versatile intermediate for the creation of various molecules with specific properties and functionalities.
| CAS Number | 6964-21-2 |
| Molecular Formula | C6H6O2S |
| Purity | ≥95% |
| IUPAC Name | 2-thiophen-3-ylacetic acid |
| InChI | InChI=1S/C6H6O2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4H,3H2,(H,7,8) |
| InChIKey | RCNOGGGBSSVMAS-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
