For research use only. Not for therapeutic Use.
3-Phenyltoxoflavin（Cat No.:I044352）is a synthetic derivative of toxoflavin, a naturally occurring bacterial toxin produced by Burkholderia gladioli. This compound features a phenyl group substitution that enhances its biological activity. 3-Phenyltoxoflavin exhibits potent antibacterial and antifungal properties, likely through the generation of reactive oxygen species and disruption of redox homeostasis in microbial cells. It has been explored as a potential antimicrobial agent and a tool for studying oxidative stress-related mechanisms. Due to its redox-active structure, it is also investigated for its cytotoxic effects in cancer research and microbial pathogenesis studies.
| CAS Number | 32502-63-9 |
| Synonyms | 1,6-dimethyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| Molecular Formula | C13H11N5O2 |
| Purity | ≥95% |
| IUPAC Name | 1,6-dimethyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChI | InChI=1S/C13H11N5O2/c1-17-12(19)9-11(15-13(17)20)18(2)16-10(14-9)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | SFOMBJIIZPCRJH-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=CC=C3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
