3-Nitropropionic acid - CAS 504-88-1

3-Nitropropionic acid(CAT: R064480) is a naturally occurring compound that has been found in some plants and fungi. Its mode of action and pharmacological effects involve inhibiting the enzyme succinate dehydrogenase, which plays a key role in the mitochondrial electron transport chain. Pharmacologically, 3-nitropropionic acid disrupts cellular energy production by interfering with the citric acid cycle and oxidative phosphorylation, leading to energy depletion and cell dysfunction. Due to its neurotoxic effects, it has been used in research to induce neurodegenerative models, particularly mimicking aspects of Huntington’s disease. Its applications lie in understanding mitochondrial dysfunction and its potential implications in neurodegenerative disorders, providing insights into disease mechanisms and potential therapeutic strategies.

Catalog Number: R064480

CAS Number: 504-88-1

PubChem Substance ID:355112395

Molecular Formula: C3H5NO4

Molecular Weight:119.076

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms3-nitropropanoic acid

Property

Molecular Formula: C3H5NO4
Molecular Weight119.076
Target:Oxidative Phosphorylation
SolubilitySoluble in DMSO > 10 mM
Purity≥95%
StorageStore at +4C
MDLMFCD00007406

Computed Descriptor

InChIInChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)
InChIKeyWBLZUCOIBUDNBV-UHFFFAOYSA-N
SMILESC(C[N+](=O)[O-])C(=O)O