3-Nitropropionic acid(CAT: R064480) is a naturally occurring compound that has been found in some plants and fungi. Its mode of action and pharmacological effects involve inhibiting the enzyme succinate dehydrogenase, which plays a key role in the mitochondrial electron transport chain. Pharmacologically, 3-nitropropionic acid disrupts cellular energy production by interfering with the citric acid cycle and oxidative phosphorylation, leading to energy depletion and cell dysfunction. Due to its neurotoxic effects, it has been used in research to induce neurodegenerative models, particularly mimicking aspects of Huntington’s disease. Its applications lie in understanding mitochondrial dysfunction and its potential implications in neurodegenerative disorders, providing insights into disease mechanisms and potential therapeutic strategies.
| Catalog Number | R064480 |
| CAS Number | 504-88-1 |
| Synonyms | 3-nitropropanoic acid |
| Molecular Formula | C3H5NO4 |
| Purity | 95% |
| Target | Oxidative Phosphorylation |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at +4C |
| InChI | InChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6) |
| InChIKey | WBLZUCOIBUDNBV-UHFFFAOYSA-N |
| SMILES | C(C[N+](=O)[O-])C(=O)O |
