For research use only. Not for therapeutic Use.
3-Nitrophenetole (CAT: I014005) is a compound commonly employed in organic synthesis and material chemistry. Its versatile nature stems from its aromatic structure, wherein the nitro group (-NO2) serves as a key functional moiety. In organic chemistry, it can undergo various reactions to introduce new functional groups, making it a valuable intermediate in the synthesis of diverse compounds. Additionally, 3-Nitrophenetole has applications in material chemistry, contributing to the creation of novel materials with tailored properties. Its versatile reactivity and role in the material design showcase its significance in advancing both synthetic methodologies and material development.
| CAS Number | 621-52-3 |
| Synonyms | 3-Nitrophenetole; AI3-15391; AI3 15391; AI315391;3-Nitrophenetole |
| Molecular Formula | C8H9NO3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C8H9NO3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | LFOLBPDHVGDKGJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC([N+]([O-])=O)=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |