For research use only. Not for therapeutic Use.
3-Methyl-2-oxazolidone (Cat No.:M012938) is a chemical compound. It features an oxazolidone ring substituted with a methyl group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Oxazolidones are versatile heterocyclic compounds used as intermediates in the synthesis of pharmaceuticals, agrochemicals, and other functional molecules. The presence of a methyl group adds specific reactivity and functional diversity to the compound. 3-Methyl-2-oxazolidone’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 19836-78-3 |
Molecular Formula | C4H7NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methyl-1,3-oxazolidin-2-one |
InChI | InChI=1S/C4H7NO2/c1-5-2-3-7-4(5)6/h2-3H2,1H3 |
InChIKey | VWIIJDNADIEEDB-UHFFFAOYSA-N |
SMILES | CN1CCOC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |