Ellagic acid 4-O-xylopyranoside（Cat No.:M115929） is a naturally occurring compound found in certain fruits and plants. It is a glycoside, meaning it is a compound that contains a sugar molecule (xylopyranoside) attached to an aglycone (ellagic acid). This compound has been studied for its potential health benefits, including antioxidant and anti-inflammatory properties. Ellagic acid 4-O-xylopyranoside has been investigated for its role in various biological processes, including its potential anti-cancer effects. Research suggests that it may help inhibit the growth of cancer cells and induce apoptosis, making it a subject of interest for further study in cancer treatment and prevention.
| Catalog Number | M115929 |
| CAS Number | 139163-18-1 |
| Synonyms | ellagic acid 4-O-xylopyranoside |
| Molecular Formula | C19H14O12 |
| Purity | 95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 6,7,14-trihydroxy-13-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| InChI | InChI=1S/C19H14O12/c20-6-1-4-9-10-5(18(27)30-15(9)12(6)23)2-8(13(24)16(10)31-17(4)26)29-19-14(25)11(22)7(21)3-28-19/h1-2,7,11,14,19-25H,3H2/t7-,11+,14-,19+/m1/s1 |
| InChIKey | KNURQRIPZJJYQO-PJIMMEPBSA-N |
| SMILES | C1C(C(C(C(O1)OC2=C(C3=C4C(=C2)C(=O)OC5=C4C(=CC(=C5O)O)C(=O)O3)O)O)O)O |
