For research use only. Not for therapeutic Use.
3-Hexyne-2,5-diol is an organic compound featuring a triple bond between the second and third carbon atoms and hydroxyl groups at positions 2 and 5. It is widely used as a building block in organic synthesis, particularly for the creation of complex molecules, polymers, and bioactive compounds. Its unique structure, with both alkyne and diol functionalities, allows for diverse reactivity, making it useful in cross-coupling reactions, coordination chemistry, and material science applications. It contributes to advancements in synthetic chemistry and materials development.
CAS Number | 3031-66-1 |
Synonyms | NSC 409184 |
Molecular Formula | C6H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | hex-3-yne-2,5-diol |
InChI | InChI=1S/C6H10O2/c1-5(7)3-4-6(2)8/h5-8H,1-2H3 |
InChIKey | KDOWHHULNTXTNS-UHFFFAOYSA-N |
SMILES | CC(C#CC(C)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |