For research use only. Not for therapeutic Use.
(2S)-Narirutin(Cat No.:R042058)is a flavonoid glycoside predominantly found in citrus fruits. This naturally occurring compound exhibits various bioactive properties, including antioxidant, anti-inflammatory, and anticancer effects. (2S)-Narirutin is known for its potential in modulating metabolic pathways, improving vascular health, and reducing oxidative stress, making it a subject of interest in pharmacological research. Due to its ability to influence key cellular mechanisms, (2S)-Narirutin is explored for its therapeutic potential in managing chronic diseases such as cardiovascular disorders and diabetes. It offers a promising avenue for the development of functional foods and nutraceuticals.
| CAS Number | 14259-46-2 |
| Synonyms | (2S)-7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one; Narirutin; Isonaringenin; Isonaringin; Naringenin 7-O-Rutinoside; Naringenin 7-Rutinoside; Naringenin 7β-Rutinoside |
| Molecular Formula | C27H32O14 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | (2S)-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C27H32O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-7,10,16,18,20-29,31-36H,8-9H2,1H3/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | HXTFHSYLYXVTHC-AJHDJQPGSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC=C(C=C5)O)O)O)O)O)O)O)O |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |