1. Home
  2. Product
  3. Catalysts and Ligands
  4. 2,6-Di(pyridin-4-yl)naphthalene

2,6-Di(pyridin-4-yl)naphthalene - CAS 950520-39-5

2,6-Di(pyridin-4-yl)naphthalene (Cat.No:L004850) is a significant compound in materials science. Its unique structure, featuring a naphthalene core with two pyridine groups, imparts specialized electronic properties. This compound is employed as a key building block in the synthesis of organic semiconductors for use in electronic devices. Its versatile nature and specific attributes make it an essential component in the development of advanced materials, emphasizing its importance in contemporary chemical research for the creation of innovative materials for various industries.

Catalog Number: L004850

CAS Number: 950520-39-5

Molecular Formula: C20H14N2

Molecular Weight:282.3

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C20H14N2
Molecular Weight282.3
Purity≥95%

Computed Descriptor

IUPAC Name4-(6-pyridin-4-ylnaphthalen-2-yl)pyridine
InChIInChI=1S/C20H14N2/c1-3-19-14-18(16-7-11-22-12-8-16)2-4-20(19)13-17(1)15-5-9-21-10-6-15/h1-14H
InChIKeyLJFCQYVWDOGEPV-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)C3=CC=NC=C3)C=C1C4=CC=NC=C4