<p>
<span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">2,3,7,8-Tetrachlorodibenzofuran (CAS 51207-31-9), <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">a polychlorinated dibenzofuran, is the byproduct of chemical synthesis. It was primarily excreted via the bile into the feces in the rat. </span></span></span></p>
| Catalog Number | R046380 |
| CAS Number | 51207-31-9 |
| Synonyms | 2,3,7,8-TCDF; F 83; PCDF 83; TCDF; |
| Molecular Formula | C12H4Cl4O |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2,3,7,8-tetrachlorodibenzofuran |
| InChI | InChI=1S/C12H4Cl4O/c13-7-1-5-6-2-8(14)10(16)4-12(6)17-11(5)3-9(7)15/h1-4H |
| InChIKey | KSMVNVHUTQZITP-UHFFFAOYSA-N |
| SMILES | C1=C2C3=CC(=C(C=C3OC2=CC(=C1Cl)Cl)Cl)Cl |
| Reference | 1. <span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Birnbaum, L. S., G. M. Decad, and H. B. Matthews. "Disposition and excretion of 2, 3, 7, 8-tetrachlorodibenzofuran in the rat." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Toxicology and applied pharmacology</i><span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;"> 55.2 (1980): 342-352.</span> |
