For research use only. Not for therapeutic Use.
2-(Naphthalen-1-yl)-5-phenyloxazole(Cat No.:I043018)is an organic compound featuring an oxazole ring substituted with naphthyl and phenyl groups at the 2 and 5 positions, respectively. This structural arrangement imparts unique photophysical properties, making it valuable in the development of fluorescent probes and organic light-emitting diodes (OLEDs). The extended conjugation between the aromatic systems contributes to its fluorescence characteristics, which are harnessed in various optical applications. Proper handling and storage are essential to maintain its stability and photophysical properties.
| CAS Number | 846-63-9 |
| Synonyms | 2-naphthalen-1-yl-5-phenyl-1,3-oxazole |
| Molecular Formula | C19H13NO |
| Purity | ≥95% |
| IUPAC Name | 2-naphthalen-1-yl-5-phenyl-1,3-oxazole |
| InChI | InChI=1S/C19H13NO/c1-2-8-15(9-3-1)18-13-20-19(21-18)17-12-6-10-14-7-4-5-11-16(14)17/h1-13H |
| InChIKey | WWVFJJKBBZXWFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC4=CC=CC=C43 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |