2-Hydroxy-2-(o-chlorophenyl)cyclohexanone (Cat No.:C000825) is an organic compound with potential applications in the pharmaceutical and chemical industries. Its structure consists of a cyclohexanone ring with a hydroxy group and an ortho-chlorophenyl substituent. This compound may exhibit unique properties due to the combination of the cyclohexanone and chlorophenyl moieties. Detailed information about its specific applications, synthesis, and properties is available in scientific literature, where it is likely studied for potential therapeutic effects, as well as in the development of novel chemical reactions and as a building block in organic synthesis.
Catalog Number | C000825 |
CAS Number | 1823362-29-3 |
Synonyms | 1-Hydroxy-2-oxo-1-(o-chlorophenyl)cyclohexane; |
Molecular Formula | C₁₂H₁₃ClO₂ |
Purity | 95% |
Solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | -20°C, Inert atmosphere |
IUPAC Name | 2-(2-chlorophenyl)-2-hydroxycyclohexan-1-one |
InChI | InChI=1S/C12H13ClO2/c13-10-6-2-1-5-9(10)12(15)8-4-3-7-11(12)14/h1-2,5-6,15H,3-4,7-8H2 |
InChIKey | TXHGZWYEGMFTJB-UHFFFAOYSA-N |
SMILES | C1CCC(C(=O)C1)(C2=CC=CC=C2Cl)O |
Reference | Gao, S., et al.: Org. Process Res. Dev., 24, 555 (2020) |