2-Chloroacetamide (Cat. No: R051079) is an organic chemical raw material that can be used as herbicide and preservative in dry and paddy fields. It can also be used as a fungicide in agriculture, glue, paints, and coatings.
| Catalog Number | R051079 |
| CAS Number | 79-07-2 |
| Synonyms | α-Chloroacetamide; 2-Chloroacetamide; Chloracetamide; Chloroacetamide; KM 101; Mergal AF; Microcide; NSC 54286; NSC 8408; α-Chloroacetamide; |
| Molecular Formula | C2H4ClNO |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-chloroacetamide |
| InChI | InChI=1S/C2H4ClNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | VXIVSQZSERGHQP-UHFFFAOYSA-N |
| SMILES | C(C(=O)N)Cl |
