For research use only. Not for therapeutic Use.
2-Chloro-N,N-diethyl-5-[[4-[2-[4-[[(methylamino)carbonyl]amino]phenyl]-4-pyridinyl]-2-pyrimidinyl]am(Cat No.:R017929)is a synthetic chemical compound used in biochemical and pharmacological research. It contains several aromatic ring structures, including pyridine and pyrimidine, and features a chloro functional group that can impact its reactivity. Compounds of this type are often investigated for their role as kinase inhibitors or their interactions with cellular receptors. This molecule’s complex structure and diverse functional groups make it useful for drug discovery and research in signal transduction, providing insights into potential therapeutic pathways.
CAS Number | 1402452-15-6 |
Molecular Formula | C27H28ClN7O3S |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | -20°C |
IUPAC Name | 1-[4-[4-[2-[4-chloro-3-(diethylsulfamoyl)anilino]pyrimidin-4-yl]pyridin-2-yl]phenyl]-3-methylurea |
InChI | InChI=1S/C27H28ClN7O3S/c1-4-35(5-2)39(37,38)25-17-21(10-11-22(25)28)32-26-31-15-13-23(34-26)19-12-14-30-24(16-19)18-6-8-20(9-7-18)33-27(36)29-3/h6-17H,4-5H2,1-3H3,(H2,29,33,36)(H,31,32,34) |
InChIKey | RZFJBSIAXYEPBX-UHFFFAOYSA-N |
SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)NC2=NC=CC(=N2)C3=CC(=NC=C3)C4=CC=C(C=C4)NC(=O)NC)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |