For research use only. Not for therapeutic Use.
| CAS Number | 16234-15-4 |
| Molecular Formula | C10H10ClN3OS |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholine |
| InChI | InChI=1S/C10H10ClN3OS/c11-10-12-7-1-6-16-8(7)9(13-10)14-2-4-15-5-3-14/h1,6H,2-5H2 |
| InChIKey | HKQMXHKNXRNUCF-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC3=C2SC=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |