For research use only. Not for therapeutic Use.
2-Acetamidothiazole-5-sulfonyl chloride is a chemical compound used in organic synthesis and medicinal chemistry. This sulfonyl chloride derivative of 2-acetamidothiazole serves as a versatile building block for the preparation of pharmaceuticals and other bioactive compounds. Its reactivity allows for the introduction of the sulfonyl chloride functional group into target molecules, facilitating the synthesis of diverse chemical structures. 2-Acetamidothiazole-5-sulfonyl chloride is particularly valuable in the development of sulfonamide derivatives and other sulfonyl-containing compounds with potential applications in drug discovery and chemical research.
| CAS Number | 69812-30-2 |
| Molecular Formula | C5H5ClN2O3S2 |
| Purity | ≥95% |
| IUPAC Name | 2-acetamido-1,3-thiazole-5-sulfonyl chloride |
| InChI | InChI=1S/C5H5ClN2O3S2/c1-3(9)8-5-7-2-4(12-5)13(6,10)11/h2H,1H3,(H,7,8,9) |
| InChIKey | LYOHVKFYBJLEEP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(S1)S(=O)(=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |