For research use only. Not for therapeutic Use.
5-Isothiazolecarboxylic acid (Cat No.: M066077) is a heterocyclic organic compound featuring a five-membered isothiazole ring with a carboxylic acid group at the 5-position. It appears as a solid and serves as a valuable intermediate in pharmaceutical and agrochemical synthesis. The presence of both heteroatoms (nitrogen and sulfur) in the ring imparts unique electronic properties, making it suitable for designing bioactive molecules. Its functional groups allow for further chemical modifications, enabling its use in medicinal chemistry, coordination chemistry, and heterocyclic compound development.
| CAS Number | 10271-85-9 |
| Molecular Formula | C4H3NO2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,2-thiazole-5-carboxylic acid |
| InChI | InChI=1S/C4H3NO2S/c6-4(7)3-1-2-5-8-3/h1-2H,(H,6,7) |
| InChIKey | GGYXPOOZYZHPLB-UHFFFAOYSA-N |
| SMILES | C1=C(SN=C1)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
