For research use only. Not for therapeutic Use.
2-(5-Chloro-2-phenoxyphenyl)acetic acid is a chemical compound used primarily as an intermediate in pharmaceutical and organic synthesis. Its structure features a chlorinated phenyl ring attached to a phenoxy group and an acetic acid moiety, making it versatile for use in drug development and the synthesis of bioactive molecules. This compound is particularly valuable in creating nonsteroidal anti-inflammatory drugs (NSAIDs) and other therapeutic agents. The presence of both the chloro and phenoxy groups enhances its reactivity, allowing it to participate in a variety of chemical reactions, contributing to medicinal chemistry and research into anti-inflammatory and analgesic compounds.
CAS Number | 70958-20-2 |
Molecular Formula | C14H11ClO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(5-chloro-2-phenoxyphenyl)acetic acid |
InChI | InChI=1S/C14H11ClO3/c15-11-6-7-13(10(8-11)9-14(16)17)18-12-4-2-1-3-5-12/h1-8H,9H2,(H,16,17) |
InChIKey | PKMKNEIUKHPJAX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |