For research use only. Not for therapeutic Use.
D,L-Adrenochrome is a chemical compound derived from the oxidation of adrenaline (epinephrine). It exists as a red-colored compound and has been historically studied for its potential effects on the brain and the nervous system. Adrenochrome has been linked to various biological activities, including potential roles in oxidation-reduction reactions, though its exact physiological significance remains unclear. In the past, it garnered attention for its controversial association with psychotropic effects, though these claims are largely speculative. Today, adrenochrome is primarily of interest in biochemical research, particularly in studying oxidative stress and its impact on neurological and cardiovascular health.
CAS Number | 54-06-8 |
Synonyms | 3-Hydroxy-1-methyl-5,6-indolinedione; 2,3-Dihydro-3-hydroxy-1-methyl-1H-indole-5,6-dione; |
Molecular Formula | C9H9NO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-hydroxy-1-methyl-2,3-dihydroindole-5,6-dione |
InChI | InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3 |
InChIKey | RPHLQSHHTJORHI-UHFFFAOYSA-N |
SMILES | CN1CC(C2=CC(=O)C(=O)C=C21)O |