For research use only. Not for therapeutic Use.
2-(2,6-Dioxopiperidin-3-yl)phthalimidine（Cat No.:I044473）is a synthetic small molecule and structural analog of thalidomide, featuring a glutarimide ring fused to a phthalimide moiety. It serves as a core pharmacophore for cereblon (CRBN) binding, a substrate receptor of the CRL4 E3 ubiquitin ligase complex, making it an essential building block in the design of PROTACs (proteolysis-targeting chimeras) and molecular glue degraders. By recruiting CRBN, this compound facilitates the targeted ubiquitination and degradation of disease-relevant proteins. It is widely used in medicinal chemistry and chemical biology for targeted protein degradation research and drug development.
| CAS Number | 26581-81-7 |
| Synonyms | 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| Molecular Formula | C13H12N2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChI | InChI=1S/C13H12N2O3/c16-11-6-5-10(12(17)14-11)15-7-8-3-1-2-4-9(8)13(15)18/h1-4,10H,5-7H2,(H,14,16,17) |
| InChIKey | WENKGSGGXGQHSH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC=CC=C3C2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
