For research use only. Not for therapeutic Use.
4-Bromo-1-methyltriazole(CAT: M061565) is a valuable heterocyclic intermediate characterized by its brominated triazole structure, widely utilized in pharmaceutical chemistry, agrochemicals, and materials science. The presence of both bromo and methyl substituents imparts unique reactivity, facilitating diverse chemical transformations, including cross-coupling reactions, nucleophilic substitutions, and cyclization processes. This compound acts as a robust building block for synthesizing biologically active molecules, such as antifungal agents, antiviral drugs, and crop protection chemicals.
CAS Number | 13273-53-5 |
Molecular Formula | C3H4BrN3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-1-methyltriazole |
InChI | InChI=1S/C3H4BrN3/c1-7-2-3(4)5-6-7/h2H,1H3 |
InChIKey | RQZZFHDFPSNDKV-UHFFFAOYSA-N |
SMILES | CN1C=C(N=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |