For research use only. Not for therapeutic Use.
12-Hydroxylauric Acid(CAT: R044199) is a high-purity fatty acid derivative widely utilized in pharmaceutical, biochemical, and material science research. Featuring a 12-carbon lauric acid backbone with a hydroxyl group at the 12th position, this compound exhibits unique amphiphilic properties, making it valuable for various applications. It serves as a precursor for synthesizing bioactive compounds, specialty surfactants, and advanced materials. 12-Hydroxylauric Acid is particularly useful in studies of lipid metabolism, as well as in the development of personal care products and biodegradable polymers. Its stability and reactivity ensure reliable performance in diverse experimental setups, supporting innovation across multiple fields.
| CAS Number | 505-95-3 |
| Synonyms | 12-Hydroxydodecanoic Acid; NSC 159293; NSC 664211; ω-Hydroxydodecanoic Acid; ω-Hydroxylauric Acid |
| Molecular Formula | C12H24O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 12-hydroxydodecanoic acid |
| InChI | InChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15) |
| InChIKey | ZDHCZVWCTKTBRY-UHFFFAOYSA-N |
| SMILES | C(CCCCCC(=O)O)CCCCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |