For research use only. Not for therapeutic Use.
1,2-Epoxy-4-vinylcyclohexane is a cyclohexane derivative with an epoxy group at the 1,2-positions and a vinyl group at the 4-position. This compound is used in organic synthesis and materials science, particularly in polymer chemistry and the development of epoxy resins. The epoxy functionality provides high reactivity, enabling cross-linking and polymerization, while the vinyl group offers sites for further modification. Its unique structure allows it to serve as a versatile intermediate in synthesizing advanced materials and specialty chemicals.
| CAS Number | 106-86-5 |
| Molecular Formula | C8H12O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-ethenyl-7-oxabicyclo[4.1.0]heptane |
| InChI | InChI=1S/C8H12O/c1-2-6-3-4-7-8(5-6)9-7/h2,6-8H,1,3-5H2 |
| InChIKey | SLJFKNONPLNAPF-UHFFFAOYSA-N |
| SMILES | C=CC1CCC2C(C1)O2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |