For research use only. Not for therapeutic Use.
1,1-Diethoxyethene (Cat No.:M144158) is a chemical compound. It features two ethoxy (–OCH2CH3) groups connected by a double bond in the ethene backbone. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Diethoxyethene can be utilized as a reagent in the preparation of various organic compounds. The presence of double bonds and ethoxy groups adds specific reactivity and functional diversity to the compound. 1,1-Diethoxyethene’s role as a versatile reagent contributes to its use in various laboratory and industrial processes, supporting scientific exploration and practical applications.
CAS Number | 2678-54-8 |
Synonyms | 1,1-diethoxyethylene; Ethene, 1,1-diethoxy-; Ketene diethylacetal; Ketene diethyl acetal |
Molecular Formula | C6H12O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1,1-diethoxyethene |
InChI | InChI=1S/C6H12O2/c1-4-7-6(3)8-5-2/h3-5H2,1-2H3 |
InChIKey | VTGIVYVOVVQLRL-UHFFFAOYSA-N |
SMILES | CCOC(=C)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |