Trovafloxacin (CAT: M091062) is a broad-spectrum fluoroquinolone antibiotic. Its mechanism of action involves inhibiting bacterial DNA gyrase and topoisomerase IV enzymes, crucial for DNA replication and repair in bacteria. This disruption leads to the prevention of bacterial growth and ultimately their death. Trovafloxacin demonstrates effectiveness against a wide range of gram-negative and gram-positive bacteria, making it suitable for treating various infections, including respiratory and urinary tract infections.
| Catalog Number | M091062 |
| CAS Number | 147059-72-1 |
| Molecular Formula | C20H15F3N4O3 |
| Purity | 0% |
| Storage | -20°C |
| IUPAC Name | 7-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChI | InChI=1S/C20H15F3N4O3/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24/h1-4,7,10-11,16H,5-6,24H2,(H,29,30)/t10-,11+,16? |
| InChIKey | WVPSKSLAZQPAKQ-SOSAQKQKSA-N |
| SMILES | C1C2C(C2N)CN1C3=C(C=C4C(=O)C(=CN(C4=N3)C5=C(C=C(C=C5)F)F)C(=O)O)F |
