For research use only. Not for therapeutic Use.
1-tert-Butyl-3-nitrobenzene(Cat No.:L007144), is a chemical compound with the molecular formula C10H13NO2. It is characterized by a nitro group (-NO2) attached to the 3rd position of a benzene ring, with a tert-butyl group (-C(CH3)3) at the 1st position. This compound is valuable in organic synthesis, serving as a versatile intermediate in the creation of various specialty chemicals and pharmaceuticals. Its unique structure allows for diverse chemical transformations, making it a key component in the development of complex organic molecules. Researchers use 1-tert-Butyl-3-nitrobenzene to create specialized compounds, contributing to advancements in chemical research and industrial applications.
| CAS Number | 23132-52-7 |
| Molecular Formula | C10H13NO2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 1-tert-butyl-3-nitrobenzene |
| InChI | InChI=1S/C10H13NO2/c1-10(2,3)8-5-4-6-9(7-8)11(12)13/h4-7H,1-3H3 |
| InChIKey | ZKRDQLBHUZNPGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |