Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2,2-Bis((4R,5S)-4,5-diphenyl-4,5-dihydrooxazol-2-yl)acetonitrile
2,2-Bis((4R,5S)-4,5-diphenyl-4,5-dihydrooxazol-2-yl)acetonitrile(CAT: L000076) is a significant compound in the field of organic chemistry and materials science. This chemical features two 4R,5S-diphenyl-4,5-dihydrooxazol-2-yl groups linked by an acetonitrile bridge. It is commonly used as a key intermediate for the synthesis of organic compounds, particularly in the development of materials and specialty polymers. Its unique structure allows for precise control of molecular properties, making it valuable in the design of advanced materials with tailored characteristics.
Catalog Number | L000076 |
CAS Number | 1222193-12-5 |
Molecular Formula | C32H25N3O2 |
Purity | 95% |
IUPAC Name | 2,2-bis[(4R,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]acetonitrile |
InChI | InChI=1S/C32H25N3O2/c33-21-26(31-34-27(22-13-5-1-6-14-22)29(36-31)24-17-9-3-10-18-24)32-35-28(23-15-7-2-8-16-23)30(37-32)25-19-11-4-12-20-25/h1-20,26-30H/t27-,28-,29+,30+/m1/s1 |
InChIKey | SUCOBNJNRDBMCL-XAZDILKDSA-N |