For research use only. Not for therapeutic Use.
1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-amine(CAT: L040500) is a high-purity heterocyclic compound featuring a methyl-substituted pyrrolopyridine core with an amine functional group. This versatile molecule is widely utilized in pharmaceutical and chemical research as a building block for the synthesis of bioactive compounds and complex organic frameworks. Its unique structure makes it particularly valuable in medicinal chemistry for the development of novel therapeutic agents. With consistent quality and reliable performance, 1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-amine is a key reagent for innovative research in drug discovery, organic synthesis, and advanced material science.
CAS Number | 883986-76-3 |
Molecular Formula | C8H9N3 |
Purity | ≥95% |
IUPAC Name | 1-methylpyrrolo[2,3-b]pyridin-5-amine |
InChI | InChI=1S/C8H9N3/c1-11-3-2-6-4-7(9)5-10-8(6)11/h2-5H,9H2,1H3 |
InChIKey | MPOYMIHLKYRVQC-UHFFFAOYSA-N |
SMILES | CN1C=CC2=CC(=CN=C21)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |