Home
>
Chemical Reagents>Organic Building Blocks>
>
1-(3,4-Dimethylphenyl)ethan-1-amine hydrochloride
1-(3,4-Dimethylphenyl)ethan-1-amine hydrochloride (Cat.No:L003965) is a vital chemical compound used in pharmaceutical research. Its unique structure, incorporating a dimethylphenylamine group, imparts specific pharmacological properties. This compound serves as a valuable intermediate in the synthesis of specialized pharmaceutical agents. Its versatile reactivity and diverse applications underscore its importance in contemporary drug development, making it a significant candidate in the quest for novel therapeutic compounds.
Catalog Number | L003965 |
CAS Number | 91251-28-4 |
Molecular Formula | C10H16ClN |
Purity | 95% |
IUPAC Name | 1-(3,4-dimethylphenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C10H15N.ClH/c1-7-4-5-10(9(3)11)6-8(7)2;/h4-6,9H,11H2,1-3H3;1H |
InChIKey | UQTBJFBMMKGXGS-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C(C)N)C.Cl |