2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate (Cat No.:M122921) is a chemical compound. It is a derivative of phenolate, featuring a pyridinium group substituted at positions 2, 4, and 6 of the phenolate ring and diphenyl groups. This compound is used in coordination chemistry and as a ligand in various metal complex formations. Its unique structure makes it valuable for creating complex molecular architectures and supporting specific metal-ligand interactions. 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate’s role in metal complexation contributes to its application in catalysis, materials science, and other areas of chemical research.
| Catalog Number | M122921 |
| CAS Number | 10081-39-7 |
| Molecular Formula | C41H29NO |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2,6-diphenyl-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
| InChI | InChI=1S/C41H29NO/c43-41-37(31-18-8-2-9-19-31)28-36(29-38(41)32-20-10-3-11-21-32)42-39(33-22-12-4-13-23-33)26-35(30-16-6-1-7-17-30)27-40(42)34-24-14-5-15-25-34/h1-29H |
| InChIKey | UWOVWIIOKHRNKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=[N+](C(=C2)C3=CC=CC=C3)C4=CC(=C(C(=C4)C5=CC=CC=C5)[O-])C6=CC=CC=C6)C7=CC=CC=C7 |
