β-Nicotinamide mononucleotide (β-NMN)(CAT: I000399) is a nucleotide derivative that plays a critical role in cellular metabolism and energy production. It is an intermediate molecule in the biosynthesis of nicotinamide adenine dinucleotide (NAD+), a coenzyme involved in various cellular processes. β-NMN has gained significant attention in recent years due to its potential anti-aging properties. It is believed to enhance NAD+ levels, which decline with age, and activate sirtuins, a family of proteins associated with longevity. By increasing NAD+ levels, β-NMN may support cellular health, mitochondrial function, and overall tissue vitality. Additionally, it has been studied for its potential benefits in age-related conditions, metabolic disorders, and neurodegenerative diseases. While β-NMN shows promise, further research is needed to fully understand its mechanisms of action and therapeutic applications.
| Catalog Number | I000399 |
| CAS Number | 1094-61-7 |
| Synonyms | β-NMN, β-Nicotinamide ribose monophosphate, NMN, Nicotinamide ribotide, Nicotinamide-1-ium-1-β-D-ribofuranoside 5′-phosphate |
| Molecular Formula | C11H15N2O8P |
| Purity | 95% |
| Solubility | H2O: ≥ 35 mg/mL |
| Storage | -20°C |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| InChI | InChI=1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/t7-,8-,9-,11-/m1/s1 |
| InChIKey | DAYLJWODMCOQEW-TURQNECASA-N |
| SMILES | O[C@H]1[C@@H](O)[C@H]([N+]2=CC(C(N)=O)=CC=C2)O[C@@H]1COP(O)([O-])=O |
| Reference | 1: Ummarino S, Mozzon M, Zamporlini F, Amici A, Mazzola F, Orsomando G, Ruggieri S, Raffaelli N. Simultaneous quantitation of nicotinamide riboside, nicotinamide mononucleotide and nicotinamide adenine dinucleotide in milk by a novel enzyme-coupled assay. Food Chem. 2017 Apr 15;221:161-168. doi: 10.1016/j.foodchem.2016.10.032. Epub 2016 Oct 11. PubMed PMID: 27979136.<br /> |
